C19H16F2N2O2S — CID 171674505
(12R)-7,8-difluoro-12-methyl-4-oxo-N-(thiophen-3-ylmethyl)-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxamide (PubChem CID 171674505) has the molecular formula C19H16F2N2O2S and a molecular weight of 374.41 g/mol. Its IUPAC name is (12R)-7,8-difluoro-12-methyl-4-oxo-N-(thiophen-3-ylmethyl)-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxamide.
| Compound Name | (12R)-7,8-difluoro-12-methyl-4-oxo-N-(thiophen-3-ylmethyl)-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 171674505 |
| Molecular Formula | C19H16F2N2O2S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (12R)-7,8-difluoro-12-methyl-4-oxo-N-(thiophen-3-ylmethyl)-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxamide |
| SMILES | C[C@@H]1CCc2c(F)c(F)cc3c(=O)c(C(=O)NCc4ccsc4)cn1c23 |
| InChI | InChI=1S/C19H16F2N2O2S/c1-10-2-3-12-16(21)15(20)6-13-17(12)23(10)8-14(18(13)24)19(25)22-7-11-4-5-26-9-11/h4-6,8-10H,2-3,7H2,1H3,(H,22,25)/t10-/m1/s1 |
| InChIKey | MHAJCPYEAFTYAA-SNVBAGLBSA-N |
| XLogP | 3.78 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |