About 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid
5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid (PubChem CID 171677564) has the molecular formula C15H12F2N2O4
and a molecular weight of 322.27 g/mol. Its IUPAC name is 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid.
Molecular Properties
| Compound Name | 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid |
| PubChem CID | 171677564 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid |
| SMILES | CN(C)c1ccc(-c2cc(F)c(F)c(C(=O)O)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12F2N2O4/c1-18(2)9-3-4-10(13(7-9)19(22)23)8-5-11(15(20)21)14(17)12(16)6-8/h3-7H,1-2H3,(H,20,21) |
| InChIKey | SGKBFWGQFKQZKV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid?
The IUPAC name of 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid (CID 171677564) is 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid.
What is the SMILES notation for 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid?
The canonical SMILES for 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid is CN(C)c1ccc(-c2cc(F)c(F)c(C(=O)O)c2)c([N+](=O)[O-])c1.
What is the InChIKey of 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid?
The InChIKey is SGKBFWGQFKQZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O4/c1-18(2)9-3-4-10(13(7-9)19(22)23)8-5-11(15(20)21)14(17)12(16)6-8/h3-7H,1-2H3,(H,20,21).
What are the key properties of 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid?
5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid has a molecular weight of 322.27 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(dimethylamino)-2-nitrophenyl]-2,3-difluorobenzoic acid is sourced from PubChem (CID 171677564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).