C28H28ClN5O4S — CID 171677909
[8-[1-(4-chlorophenyl)cyclobutanecarbonyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-(6,6-dioxo-4,5-dihydroimidazo[5,1-d][1,2,5]benzothiadiazepin-3-yl)methanone (PubChem CID 171677909) has the molecular formula C28H28ClN5O4S and a molecular weight of 566.08 g/mol. Its IUPAC name is [8-[1-(4-chlorophenyl)cyclobutanecarbonyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-(6,6-dioxo-4,5-dihydroimidazo[5,1-d][1,2,5]benzothiadiazepin-3-yl)methanone.
| Compound Name | [8-[1-(4-chlorophenyl)cyclobutanecarbonyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-(6,6-dioxo-4,5-dihydroimidazo[5,1-d][1,2,5]benzothiadiazepin-3-yl)methanone |
|---|---|
| PubChem CID | 171677909 |
| Molecular Formula | C28H28ClN5O4S |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | [8-[1-(4-chlorophenyl)cyclobutanecarbonyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-(6,6-dioxo-4,5-dihydroimidazo[5,1-d][1,2,5]benzothiadiazepin-3-yl)methanone |
| SMILES | O=C(c1ncn2c1CNS(=O)(=O)c1ccccc1-2)N1CC2CCC(C1)N2C(=O)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C28H28ClN5O4S/c29-19-8-6-18(7-9-19)28(12-3-13-28)27(36)34-20-10-11-21(34)16-32(15-20)26(35)25-23-14-31-39(37,38)24-5-2-1-4-22(24)33(23)17-30-25/h1-2,4-9,17,20-21,31H,3,10-16H2 |
| InChIKey | OAEPINMDHZOKEH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |