C29H35ClN2O4 — CID 171678400
N-[[(3aS,6aR)-2-(4,5-dimethoxy-2-methylbenzoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methyl]-1-(4-chlorophenyl)cyclobutane-1-carboxamide (PubChem CID 171678400) has the molecular formula C29H35ClN2O4 and a molecular weight of 511.06 g/mol. Its IUPAC name is N-[[(3aS,6aR)-2-(4,5-dimethoxy-2-methylbenzoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methyl]-1-(4-chlorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[[(3aS,6aR)-2-(4,5-dimethoxy-2-methylbenzoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methyl]-1-(4-chlorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 171678400 |
| Molecular Formula | C29H35ClN2O4 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[[(3aS,6aR)-2-(4,5-dimethoxy-2-methylbenzoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methyl]-1-(4-chlorophenyl)cyclobutane-1-carboxamide |
| SMILES | COc1cc(C)c(C(=O)N2C[C@@H]3CCC[C@]3(CNC(=O)C3(c4ccc(Cl)cc4)CCC3)C2)cc1OC |
| InChI | InChI=1S/C29H35ClN2O4/c1-19-14-24(35-2)25(36-3)15-23(19)26(33)32-16-21-6-4-11-28(21,18-32)17-31-27(34)29(12-5-13-29)20-7-9-22(30)10-8-20/h7-10,14-15,21H,4-6,11-13,16-18H2,1-3H3,(H,31,34)/t21-,28-/m0/s1 |
| InChIKey | SMUBAOKSAJOZJD-KMRXNPHXSA-N |
| XLogP | 5.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |