C24H26N2O3 — CID 171678550
1-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-3-(2-phenylphenyl)urea (PubChem CID 171678550) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-3-(2-phenylphenyl)urea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 171678550 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-3-(2-phenylphenyl)urea |
| SMILES | COc1ccc(CCN(C)C(=O)Nc2ccccc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H26N2O3/c1-26(16-15-18-13-14-22(28-2)23(17-18)29-3)24(27)25-21-12-8-7-11-20(21)19-9-5-4-6-10-19/h4-14,17H,15-16H2,1-3H3,(H,25,27) |
| InChIKey | HLBOIEYJXGHADU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |