C12H12N4O3S — CID 171678761
1,1-dioxo-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]thietane-3-carboxamide (PubChem CID 171678761) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]thietane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]thietane-3-carboxamide |
|---|---|
| PubChem CID | 171678761 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1,1-dioxo-N-[2-(1H-1,2,4-triazol-5-yl)phenyl]thietane-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ncn[nH]1)C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12N4O3S/c17-12(8-5-20(18,19)6-8)15-10-4-2-1-3-9(10)11-13-7-14-16-11/h1-4,7-8H,5-6H2,(H,15,17)(H,13,14,16) |
| InChIKey | HHYLGFRAEBKCPJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |