About 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine
2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine (PubChem CID 171678881) has the molecular formula C23H20ClFN6O
and a molecular weight of 450.91 g/mol. Its IUPAC name is 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine.
Molecular Properties
| Compound Name | 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine |
| PubChem CID | 171678881 |
| Molecular Formula | C23H20ClFN6O |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine |
| SMILES | Fc1cnc2ccc(N3CCN(c4cncc(OCc5cccc(Cl)c5)n4)CC3)nc2c1 |
| InChI | InChI=1S/C23H20ClFN6O/c24-17-3-1-2-16(10-17)15-32-23-14-26-13-22(29-23)31-8-6-30(7-9-31)21-5-4-19-20(28-21)11-18(25)12-27-19/h1-5,10-14H,6-9,15H2 |
| InChIKey | FKIBANUNAPSEGC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine?
The IUPAC name of 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine (CID 171678881) is 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine.
What is the SMILES notation for 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine?
The canonical SMILES for 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine is Fc1cnc2ccc(N3CCN(c4cncc(OCc5cccc(Cl)c5)n4)CC3)nc2c1.
What is the InChIKey of 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine?
The InChIKey is FKIBANUNAPSEGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClFN6O/c24-17-3-1-2-16(10-17)15-32-23-14-26-13-22(29-23)31-8-6-30(7-9-31)21-5-4-19-20(28-21)11-18(25)12-27-19/h1-5,10-14H,6-9,15H2.
What are the key properties of 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine?
2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine has a molecular weight of 450.91 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]piperazin-1-yl]-7-fluoro-1,5-naphthyridine is sourced from PubChem (CID 171678881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).