C19H19F2N3O4 — CID 171679055
(4R)-3-[4-(3,4-difluoro-5-methoxyanilino)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one;formic acid (PubChem CID 171679055) has the molecular formula C19H19F2N3O4 and a molecular weight of 391.37 g/mol. Its IUPAC name is (4R)-3-[4-(3,4-difluoro-5-methoxyanilino)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one;formic acid.
| Compound Name | (4R)-3-[4-(3,4-difluoro-5-methoxyanilino)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one;formic acid |
|---|---|
| PubChem CID | 171679055 |
| Molecular Formula | C19H19F2N3O4 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (4R)-3-[4-(3,4-difluoro-5-methoxyanilino)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one;formic acid |
| SMILES | COc1cc(Nc2ccc(C3=NNC(=O)C[C@H]3C)cc2)cc(F)c1F.O=CO |
| InChI | InChI=1S/C18H17F2N3O2.CH2O2/c1-10-7-16(24)22-23-18(10)11-3-5-12(6-4-11)21-13-8-14(19)17(20)15(9-13)25-2;2-1-3/h3-6,8-10,21H,7H2,1-2H3,(H,22,24);1H,(H,2,3)/t10-;/m1./s1 |
| InChIKey | NVAMPVSVVUDXTN-HNCPQSOCSA-N |
| XLogP | 3.28 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|