C14H14F3N3O5S — CID 171680185
1,1-dioxo-5-[2-[4-(trifluoromethoxy)phenyl]acetyl]-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one (PubChem CID 171680185) has the molecular formula C14H14F3N3O5S and a molecular weight of 393.34 g/mol. Its IUPAC name is 1,1-dioxo-5-[2-[4-(trifluoromethoxy)phenyl]acetyl]-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one.
| Compound Name | 1,1-dioxo-5-[2-[4-(trifluoromethoxy)phenyl]acetyl]-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 171680185 |
| Molecular Formula | C14H14F3N3O5S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 1,1-dioxo-5-[2-[4-(trifluoromethoxy)phenyl]acetyl]-3a,4,6,7-tetrahydro-[1,2,5]thiadiazolo[2,3-a]pyrazin-3-one |
| SMILES | O=C1NS(=O)(=O)N2CCN(C(=O)Cc3ccc(OC(F)(F)F)cc3)CC12 |
| InChI | InChI=1S/C14H14F3N3O5S/c15-14(16,17)25-10-3-1-9(2-4-10)7-12(21)19-5-6-20-11(8-19)13(22)18-26(20,23)24/h1-4,11H,5-8H2,(H,18,22) |
| InChIKey | GTUNRYCZUMYTGQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |