C14H14ClN3OS — CID 17168198
6-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide (PubChem CID 17168198) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 6-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17168198 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide |
| SMILES | CC1CCc2nc(NC(=O)c3ccc(Cl)nc3)sc2C1 |
| InChI | InChI=1S/C14H14ClN3OS/c1-8-2-4-10-11(6-8)20-14(17-10)18-13(19)9-3-5-12(15)16-7-9/h3,5,7-8H,2,4,6H2,1H3,(H,17,18,19) |
| InChIKey | JYJXPSOLRXLYAA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|