About N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide
N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide (PubChem CID 171682635) has the molecular formula C19H16F2N4O
and a molecular weight of 354.36 g/mol. Its IUPAC name is N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
| PubChem CID | 171682635 |
| Molecular Formula | C19H16F2N4O |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
| SMILES | Cn1cc(-c2ccnc(C(=O)NC3CCc4c(F)cc(F)cc43)c2)cn1 |
| InChI | InChI=1S/C19H16F2N4O/c1-25-10-12(9-23-25)11-4-5-22-18(6-11)19(26)24-17-3-2-14-15(17)7-13(20)8-16(14)21/h4-10,17H,2-3H2,1H3,(H,24,26) |
| InChIKey | LDFMZUKBIYEAKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide?
The IUPAC name of N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide (CID 171682635) is N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide.
What is the SMILES notation for N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide?
The canonical SMILES for N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide is Cn1cc(-c2ccnc(C(=O)NC3CCc4c(F)cc(F)cc43)c2)cn1.
What is the InChIKey of N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide?
The InChIKey is LDFMZUKBIYEAKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N4O/c1-25-10-12(9-23-25)11-4-5-22-18(6-11)19(26)24-17-3-2-14-15(17)7-13(20)8-16(14)21/h4-10,17H,2-3H2,1H3,(H,24,26).
What are the key properties of N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide?
N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide has a molecular weight of 354.36 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-difluoro-2,3-dihydro-1H-inden-1-yl)-4-(1-methylpyrazol-4-yl)pyridine-2-carboxamide is sourced from PubChem (CID 171682635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).