C28H26FN3O4S — CID 171683224
N-[4-[1-(2-fluoro-5-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]-1H-indole-6-carboxamide (PubChem CID 171683224) has the molecular formula C28H26FN3O4S and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[4-[1-(2-fluoro-5-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]-1H-indole-6-carboxamide.
| Compound Name | N-[4-[1-(2-fluoro-5-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 171683224 |
| Molecular Formula | C28H26FN3O4S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-[4-[1-(2-fluoro-5-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]-1H-indole-6-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(C(=O)N2CCC(c3ccc(NC(=O)c4ccc5cc[nH]c5c4)cc3)CC2)c1 |
| InChI | InChI=1S/C28H26FN3O4S/c1-37(35,36)23-8-9-25(29)24(17-23)28(34)32-14-11-19(12-15-32)18-4-6-22(7-5-18)31-27(33)21-3-2-20-10-13-30-26(20)16-21/h2-10,13,16-17,19,30H,11-12,14-15H2,1H3,(H,31,33) |
| InChIKey | GZYUBSXWHIPLGY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |