C27H28ClN5O4 — CID 171684115
(E)-N-[4-[1-(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)piperidin-4-yl]phenyl]-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 171684115) has the molecular formula C27H28ClN5O4 and a molecular weight of 522.01 g/mol. Its IUPAC name is (E)-N-[4-[1-(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)piperidin-4-yl]phenyl]-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[1-(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)piperidin-4-yl]phenyl]-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 171684115 |
| Molecular Formula | C27H28ClN5O4 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (E)-N-[4-[1-(4-chloro-3-ethyl-1-methylpyrazole-5-carbonyl)piperidin-4-yl]phenyl]-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | CCc1nn(C)c(C(=O)N2CCC(c3ccc(NC(=O)/C=C/c4ccccc4[N+](=O)[O-])cc3)CC2)c1Cl |
| InChI | InChI=1S/C27H28ClN5O4/c1-3-22-25(28)26(31(2)30-22)27(35)32-16-14-19(15-17-32)18-8-11-21(12-9-18)29-24(34)13-10-20-6-4-5-7-23(20)33(36)37/h4-13,19H,3,14-17H2,1-2H3,(H,29,34)/b13-10+ |
| InChIKey | KAPPXZLGNNQPOC-JLHYYAGUSA-N |
| XLogP | 5.22 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|