C29H28F3N3O4 — CID 171684678
N-[(3aR,6aS)-1-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-4,5-dimethoxy-2-methylbenzamide (PubChem CID 171684678) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is N-[(3aR,6aS)-1-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-4,5-dimethoxy-2-methylbenzamide.
| Compound Name | N-[(3aR,6aS)-1-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-4,5-dimethoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 171684678 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | N-[(3aR,6aS)-1-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-4,5-dimethoxy-2-methylbenzamide |
| SMILES | COc1cc(C)c(C(=O)N[C@@]23CCC[C@@H]2N(C(=O)c2ccc(F)c(-c4c(F)cccc4F)n2)CC3)cc1OC |
| InChI | InChI=1S/C29H28F3N3O4/c1-16-14-22(38-2)23(39-3)15-17(16)27(36)34-29-11-5-8-24(29)35(13-12-29)28(37)21-10-9-20(32)26(33-21)25-18(30)6-4-7-19(25)31/h4,6-7,9-10,14-15,24H,5,8,11-13H2,1-3H3,(H,34,36)/t24-,29+/m0/s1 |
| InChIKey | WBOKBIFHNRTBLW-PWUYWRBVSA-N |
| XLogP | 5.06 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |