C29H26N4O4S — CID 171684708
[4-[3-(benzenesulfonyl)quinolin-8-yl]piperazin-1-yl]-(5-methoxy-1H-indol-3-yl)methanone (PubChem CID 171684708) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is [4-[3-(benzenesulfonyl)quinolin-8-yl]piperazin-1-yl]-(5-methoxy-1H-indol-3-yl)methanone.
| Compound Name | [4-[3-(benzenesulfonyl)quinolin-8-yl]piperazin-1-yl]-(5-methoxy-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 171684708 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | [4-[3-(benzenesulfonyl)quinolin-8-yl]piperazin-1-yl]-(5-methoxy-1H-indol-3-yl)methanone |
| SMILES | COc1ccc2[nH]cc(C(=O)N3CCN(c4cccc5cc(S(=O)(=O)c6ccccc6)cnc45)CC3)c2c1 |
| InChI | InChI=1S/C29H26N4O4S/c1-37-21-10-11-26-24(17-21)25(19-30-26)29(34)33-14-12-32(13-15-33)27-9-5-6-20-16-23(18-31-28(20)27)38(35,36)22-7-3-2-4-8-22/h2-11,16-19,30H,12-15H2,1H3 |
| InChIKey | REWOEYHZLCTQFE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |