C20H21N3O2 — CID 17168589
1-cyclohexyl-5-(2-methylphenyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 17168589) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-cyclohexyl-5-(2-methylphenyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-cyclohexyl-5-(2-methylphenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17168589 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-cyclohexyl-5-(2-methylphenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccccc1-c1ccnc2c1c(=O)[nH]c(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C20H21N3O2/c1-13-7-5-6-10-15(13)16-11-12-21-18-17(16)19(24)22-20(25)23(18)14-8-3-2-4-9-14/h5-7,10-12,14H,2-4,8-9H2,1H3,(H,22,24,25) |
| InChIKey | BQVFLKKERXVVSN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |