C16H19F3N2O3 — CID 171686481
N-pyridin-4-ylspiro[2.5]octane-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171686481) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-pyridin-4-ylspiro[2.5]octane-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-pyridin-4-ylspiro[2.5]octane-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171686481 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-pyridin-4-ylspiro[2.5]octane-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccncc1)C1CC12CCCCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N2O.C2HF3O2/c17-13(16-11-4-8-15-9-5-11)12-10-14(12)6-2-1-3-7-14;3-2(4,5)1(6)7/h4-5,8-9,12H,1-3,6-7,10H2,(H,15,16,17);(H,6,7) |
| InChIKey | VSAKAFWNLZZJHP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |