C21H25N3O6S2 — CID 171686558
formic acid;N-[2-oxo-2-[(2'S,3R)-2-oxo-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-1'-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 171686558) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is formic acid;N-[2-oxo-2-[(2'S,3R)-2-oxo-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-1'-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | formic acid;N-[2-oxo-2-[(2'S,3R)-2-oxo-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-1'-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 171686558 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | formic acid;N-[2-oxo-2-[(2'S,3R)-2-oxo-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-1'-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | CCC[C@@H]1N(C(=O)CNS(=O)(=O)c2cccs2)CC[C@]12C(=O)Nc1ccccc12.O=CO |
| InChI | InChI=1S/C20H23N3O4S2.CH2O2/c1-2-6-16-20(14-7-3-4-8-15(14)22-19(20)25)10-11-23(16)17(24)13-21-29(26,27)18-9-5-12-28-18;2-1-3/h3-5,7-9,12,16,21H,2,6,10-11,13H2,1H3,(H,22,25);1H,(H,2,3)/t16-,20+;/m0./s1 |
| InChIKey | GYFGHAXJKWGKIL-VASSOYJASA-N |
| XLogP | 2.02 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|