C21H30Cl2N4O2 — CID 171687182
4-methoxy-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-3-(pyrrolidin-3-ylmethyl)benzamide;dihydrochloride (PubChem CID 171687182) has the molecular formula C21H30Cl2N4O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-3-(pyrrolidin-3-ylmethyl)benzamide;dihydrochloride.
| Compound Name | 4-methoxy-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-3-(pyrrolidin-3-ylmethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 171687182 |
| Molecular Formula | C21H30Cl2N4O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-methoxy-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]-3-(pyrrolidin-3-ylmethyl)benzamide;dihydrochloride |
| SMILES | COc1ccc(C(=O)NCCNc2ncccc2C)cc1CC1CCNC1.Cl.Cl |
| InChI | InChI=1S/C21H28N4O2.2ClH/c1-15-4-3-8-23-20(15)24-10-11-25-21(26)17-5-6-19(27-2)18(13-17)12-16-7-9-22-14-16;;/h3-6,8,13,16,22H,7,9-12,14H2,1-2H3,(H,23,24)(H,25,26);2*1H |
| InChIKey | FLLQQCRSNHZBME-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|