About 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride
5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride (PubChem CID 171687283) has the molecular formula C14H22Cl2N4O2
and a molecular weight of 349.26 g/mol. Its IUPAC name is 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride |
| PubChem CID | 171687283 |
| Molecular Formula | C14H22Cl2N4O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride |
| SMILES | Cc1nc(C2CCNCC2)cc(N2CC(C)OC2=O)n1.Cl.Cl |
| InChI | InChI=1S/C14H20N4O2.2ClH/c1-9-8-18(14(19)20-9)13-7-12(16-10(2)17-13)11-3-5-15-6-4-11;;/h7,9,11,15H,3-6,8H2,1-2H3;2*1H |
| InChIKey | GSPXRQZSGLTVDJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride?
The IUPAC name of 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride (CID 171687283) is 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride.
What is the SMILES notation for 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride?
The canonical SMILES for 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride is Cc1nc(C2CCNCC2)cc(N2CC(C)OC2=O)n1.Cl.Cl.
What is the InChIKey of 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride?
The InChIKey is GSPXRQZSGLTVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2.2ClH/c1-9-8-18(14(19)20-9)13-7-12(16-10(2)17-13)11-3-5-15-6-4-11;;/h7,9,11,15H,3-6,8H2,1-2H3;2*1H.
What are the key properties of 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride?
5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride has a molecular weight of 349.26 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)-1,3-oxazolidin-2-one;dihydrochloride is sourced from PubChem (CID 171687283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).