C16H24ClN5 — CID 171687287
2-(piperidin-4-ylmethyl)-3-(2-propan-2-ylpyrazol-3-yl)pyrazine;hydrochloride (PubChem CID 171687287) has the molecular formula C16H24ClN5 and a molecular weight of 321.86 g/mol. Its IUPAC name is 2-(piperidin-4-ylmethyl)-3-(2-propan-2-ylpyrazol-3-yl)pyrazine;hydrochloride.
| Compound Name | 2-(piperidin-4-ylmethyl)-3-(2-propan-2-ylpyrazol-3-yl)pyrazine;hydrochloride |
|---|---|
| PubChem CID | 171687287 |
| Molecular Formula | C16H24ClN5 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-(piperidin-4-ylmethyl)-3-(2-propan-2-ylpyrazol-3-yl)pyrazine;hydrochloride |
| SMILES | CC(C)n1nccc1-c1nccnc1CC1CCNCC1.Cl |
| InChI | InChI=1S/C16H23N5.ClH/c1-12(2)21-15(5-8-20-21)16-14(18-9-10-19-16)11-13-3-6-17-7-4-13;/h5,8-10,12-13,17H,3-4,6-7,11H2,1-2H3;1H |
| InChIKey | VJWQXUPMZKEDOH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |