C29H37ClFN5O4 — CID 171687595
5-(4-fluorophenyl)-5-[3-[2-(3-methylbutanoyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-6-yl]-3-oxopropyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 171687595) has the molecular formula C29H37ClFN5O4 and a molecular weight of 574.10 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-[3-[2-(3-methylbutanoyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-6-yl]-3-oxopropyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-(4-fluorophenyl)-5-[3-[2-(3-methylbutanoyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-6-yl]-3-oxopropyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 171687595 |
| Molecular Formula | C29H37ClFN5O4 |
| Molecular Weight | 574.10 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 5-(4-fluorophenyl)-5-[3-[2-(3-methylbutanoyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-6-yl]-3-oxopropyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | CC(C)CC(=O)N1CCCN(C(=O)CCC2(c3ccc(F)cc3)NC(=O)NC2=O)CCNCc2ccccc21.Cl |
| InChI | InChI=1S/C29H36FN5O4.ClH/c1-20(2)18-26(37)35-16-5-15-34(17-14-31-19-21-6-3-4-7-24(21)35)25(36)12-13-29(27(38)32-28(39)33-29)22-8-10-23(30)11-9-22;/h3-4,6-11,20,31H,5,12-19H2,1-2H3,(H2,32,33,38,39);1H |
| InChIKey | BGMIIZFCCNIHDT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|