C16H28Cl3N3 — CID 171687634
9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-triene;trihydrochloride (PubChem CID 171687634) has the molecular formula C16H28Cl3N3 and a molecular weight of 368.78 g/mol. Its IUPAC name is 9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-triene;trihydrochloride.
| Compound Name | 9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-triene;trihydrochloride |
|---|---|
| PubChem CID | 171687634 |
| Molecular Formula | C16H28Cl3N3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-triene;trihydrochloride |
| SMILES | Cc1cccc2c1NCCC1CCC(CNC2)N1C.Cl.Cl.Cl |
| InChI | InChI=1S/C16H25N3.3ClH/c1-12-4-3-5-13-10-17-11-15-7-6-14(19(15)2)8-9-18-16(12)13;;;/h3-5,14-15,17-18H,6-11H2,1-2H3;3*1H |
| InChIKey | RYVJNRQPCUANLQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |