C17H12N6S — CID 17168771
3-[(2-pyridin-4-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]propanenitrile (PubChem CID 17168771) has the molecular formula C17H12N6S and a molecular weight of 332.39 g/mol. Its IUPAC name is 3-[(2-pyridin-4-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]propanenitrile.
| Compound Name | 3-[(2-pyridin-4-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 17168771 |
| Molecular Formula | C17H12N6S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[(2-pyridin-4-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nc2ccccc2c2nc(-c3ccncc3)nn12 |
| InChI | InChI=1S/C17H12N6S/c18-8-3-11-24-17-20-14-5-2-1-4-13(14)16-21-15(22-23(16)17)12-6-9-19-10-7-12/h1-2,4-7,9-10H,3,11H2 |
| InChIKey | ONPKXRZRHZEDDN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|