C21H31N3O4 — CID 171688217
3-[(3aR,9aS)-4-[(3-methylphenyl)methyl]-5-oxo-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]propanamide;formic acid (PubChem CID 171688217) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[(3aR,9aS)-4-[(3-methylphenyl)methyl]-5-oxo-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]propanamide;formic acid.
| Compound Name | 3-[(3aR,9aS)-4-[(3-methylphenyl)methyl]-5-oxo-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]propanamide;formic acid |
|---|---|
| PubChem CID | 171688217 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 3-[(3aR,9aS)-4-[(3-methylphenyl)methyl]-5-oxo-2,3,3a,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]propanamide;formic acid |
| SMILES | Cc1cccc(CN2C(=O)CCCC[C@H]3[C@H]2CCN3CCC(N)=O)c1.O=CO |
| InChI | InChI=1S/C20H29N3O2.CH2O2/c1-15-5-4-6-16(13-15)14-23-18-9-11-22(12-10-19(21)24)17(18)7-2-3-8-20(23)25;2-1-3/h4-6,13,17-18H,2-3,7-12,14H2,1H3,(H2,21,24);1H,(H,2,3)/t17-,18+;/m0./s1 |
| InChIKey | UKYMAPMOGZLTRL-CJRXIRLBSA-N |
| XLogP | 1.92 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|