C13H16N6O — CID 171689533
3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(piperidin-4-ylideneamino)pyridin-2-amine (PubChem CID 171689533) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(piperidin-4-ylideneamino)pyridin-2-amine.
| Compound Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(piperidin-4-ylideneamino)pyridin-2-amine |
|---|---|
| PubChem CID | 171689533 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(piperidin-4-ylideneamino)pyridin-2-amine |
| SMILES | Cc1noc(-c2cccnc2NN=C2CCNCC2)n1 |
| InChI | InChI=1S/C13H16N6O/c1-9-16-13(20-19-9)11-3-2-6-15-12(11)18-17-10-4-7-14-8-5-10/h2-3,6,14H,4-5,7-8H2,1H3,(H,15,18) |
| InChIKey | PNHSPESQKNNXGJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|