C16H18F3N5S — CID 171690471
2-methylsulfanyl-4-[4-[[2-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]pyrimidine (PubChem CID 171690471) has the molecular formula C16H18F3N5S and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-methylsulfanyl-4-[4-[[2-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-methylsulfanyl-4-[4-[[2-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 171690471 |
| Molecular Formula | C16H18F3N5S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-methylsulfanyl-4-[4-[[2-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]pyrimidine |
| SMILES | CSc1nccc(N2CCN(Cc3cccnc3C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C16H18F3N5S/c1-25-15-21-6-4-13(22-15)24-9-7-23(8-10-24)11-12-3-2-5-20-14(12)16(17,18)19/h2-6H,7-11H2,1H3 |
| InChIKey | SVEXCZMKAHDSDG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |