C19H21N5OS — CID 171690713
2-methyl-6-[5-(4-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridazin-3-one (PubChem CID 171690713) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-methyl-6-[5-(4-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridazin-3-one.
| Compound Name | 2-methyl-6-[5-(4-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 171690713 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-methyl-6-[5-(4-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridazin-3-one |
| SMILES | Cc1cccc2sc(N3CC4CN(c5ccc(=O)n(C)n5)CC4C3)nc12 |
| InChI | InChI=1S/C19H21N5OS/c1-12-4-3-5-15-18(12)20-19(26-15)24-10-13-8-23(9-14(13)11-24)16-6-7-17(25)22(2)21-16/h3-7,13-14H,8-11H2,1-2H3 |
| InChIKey | DTBVUFAWBPJDJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |