C14H16N4O3 — CID 171690760
furan-2-yl-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone (PubChem CID 171690760) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is furan-2-yl-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171690760 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | furan-2-yl-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1cncc(N2CCN(C(=O)c3ccco3)CC2)n1 |
| InChI | InChI=1S/C14H16N4O3/c1-20-13-10-15-9-12(16-13)17-4-6-18(7-5-17)14(19)11-3-2-8-21-11/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | ODHLBBHPFWHOGO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |