C19H23FN4O — CID 171691064
N-(3,5-dimethylphenyl)-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]acetamide (PubChem CID 171691064) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 171691064 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CN2CCN(c3cccc(F)n3)CC2)c1 |
| InChI | InChI=1S/C19H23FN4O/c1-14-10-15(2)12-16(11-14)21-19(25)13-23-6-8-24(9-7-23)18-5-3-4-17(20)22-18/h3-5,10-12H,6-9,13H2,1-2H3,(H,21,25) |
| InChIKey | DIFTWIMTHGCUOB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|