About 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile
5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile (PubChem CID 171692000) has the molecular formula C21H14FN3O2S
and a molecular weight of 391.43 g/mol. Its IUPAC name is 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 171692000 |
| Molecular Formula | C21H14FN3O2S |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2cccs2)oc1NCc1ccc(Oc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H14FN3O2S/c22-16-4-1-2-5-18(16)26-15-9-7-14(8-10-15)13-24-20-17(12-23)25-21(27-20)19-6-3-11-28-19/h1-11,24H,13H2 |
| InChIKey | CSTJGTRUJQHGKT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile (CID 171692000) is 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile is N#Cc1nc(-c2cccs2)oc1NCc1ccc(Oc2ccccc2F)cc1.
What is the InChIKey of 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile?
The InChIKey is CSTJGTRUJQHGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14FN3O2S/c22-16-4-1-2-5-18(16)26-15-9-7-14(8-10-15)13-24-20-17(12-23)25-21(27-20)19-6-3-11-28-19/h1-11,24H,13H2.
What are the key properties of 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile?
5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile has a molecular weight of 391.43 g/mol, XLogP of 5.82, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(2-fluorophenoxy)phenyl]methylamino]-2-thiophen-2-yl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 171692000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).