C28H31ClN2O4S — CID 171692060
N-[2-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]ethyl]-5-chloro-2-methoxybenzamide (PubChem CID 171692060) has the molecular formula C28H31ClN2O4S and a molecular weight of 527.09 g/mol. Its IUPAC name is N-[2-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]ethyl]-5-chloro-2-methoxybenzamide.
| Compound Name | N-[2-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]ethyl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 171692060 |
| Molecular Formula | C28H31ClN2O4S |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N-[2-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]ethyl]-5-chloro-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H31ClN2O4S/c1-35-27-12-9-24(29)20-26(27)28(32)30-16-13-21-7-10-25(11-8-21)36(33,34)31-17-14-23(15-18-31)19-22-5-3-2-4-6-22/h2-12,20,23H,13-19H2,1H3,(H,30,32) |
| InChIKey | LZNVFXLWHVPSBC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |