About 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride
2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride (PubChem CID 171692068) has the molecular formula C15H17ClN4O3S
and a molecular weight of 368.85 g/mol. Its IUPAC name is 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride |
| PubChem CID | 171692068 |
| Molecular Formula | C15H17ClN4O3S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride |
| SMILES | Cc1ccccc1-c1nc(C#N)c(S(=O)(=O)N2CCNCC2)o1.Cl |
| InChI | InChI=1S/C15H16N4O3S.ClH/c1-11-4-2-3-5-12(11)14-18-13(10-16)15(22-14)23(20,21)19-8-6-17-7-9-19;/h2-5,17H,6-9H2,1H3;1H |
| InChIKey | FHZFUBNAQXLUCU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride?
The IUPAC name of 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride (CID 171692068) is 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride.
What is the SMILES notation for 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride?
The canonical SMILES for 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride is Cc1ccccc1-c1nc(C#N)c(S(=O)(=O)N2CCNCC2)o1.Cl.
What is the InChIKey of 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride?
The InChIKey is FHZFUBNAQXLUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3S.ClH/c1-11-4-2-3-5-12(11)14-18-13(10-16)15(22-14)23(20,21)19-8-6-17-7-9-19;/h2-5,17H,6-9H2,1H3;1H.
What are the key properties of 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride?
2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride has a molecular weight of 368.85 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)-5-piperazin-1-ylsulfonyl-1,3-oxazole-4-carbonitrile;hydrochloride is sourced from PubChem (CID 171692068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).