C19H20F3N3O5S — CID 171692867
8-benzyl-5-methyl-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 171692867) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is 8-benzyl-5-methyl-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 8-benzyl-5-methyl-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171692867 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 8-benzyl-5-methyl-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC2Oc3ncccc3S(=O)(=O)N(Cc3ccccc3)C2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19N3O3S.C2HF3O2/c1-19-11-14-15(12-19)23-17-16(8-5-9-18-17)24(21,22)20(14)10-13-6-3-2-4-7-13;3-2(4,5)1(6)7/h2-9,14-15H,10-12H2,1H3;(H,6,7) |
| InChIKey | JIEOAYBOPMQPFE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |