C19H28F2N2O4 — CID 171694032
8-[(3,4-difluorophenyl)methyl]-4-propan-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;formic acid (PubChem CID 171694032) has the molecular formula C19H28F2N2O4 and a molecular weight of 386.44 g/mol. Its IUPAC name is 8-[(3,4-difluorophenyl)methyl]-4-propan-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;formic acid.
| Compound Name | 8-[(3,4-difluorophenyl)methyl]-4-propan-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;formic acid |
|---|---|
| PubChem CID | 171694032 |
| Molecular Formula | C19H28F2N2O4 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 8-[(3,4-difluorophenyl)methyl]-4-propan-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;formic acid |
| SMILES | CC(C)N1CCOC2(COCCN(Cc3ccc(F)c(F)c3)C2)C1.O=CO |
| InChI | InChI=1S/C18H26F2N2O2.CH2O2/c1-14(2)22-6-8-24-18(12-22)11-21(5-7-23-13-18)10-15-3-4-16(19)17(20)9-15;2-1-3/h3-4,9,14H,5-8,10-13H2,1-2H3;1H,(H,2,3) |
| InChIKey | QYMUCMFKMXZIQW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|