C21H29F6N3O6 — CID 171694173
(4S,5R)-10-[(2-methoxy-3-pyridinyl)methyl]-2,4-dimethyl-7-oxa-2,10-diazaspiro[4.6]undecane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171694173) has the molecular formula C21H29F6N3O6 and a molecular weight of 533.47 g/mol. Its IUPAC name is (4S,5R)-10-[(2-methoxy-3-pyridinyl)methyl]-2,4-dimethyl-7-oxa-2,10-diazaspiro[4.6]undecane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4S,5R)-10-[(2-methoxy-3-pyridinyl)methyl]-2,4-dimethyl-7-oxa-2,10-diazaspiro[4.6]undecane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171694173 |
| Molecular Formula | C21H29F6N3O6 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (4S,5R)-10-[(2-methoxy-3-pyridinyl)methyl]-2,4-dimethyl-7-oxa-2,10-diazaspiro[4.6]undecane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ncccc1CN1CCOC[C@]2(CN(C)C[C@H]2C)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O2.2C2HF3O2/c1-14-9-19(2)11-17(14)12-20(7-8-22-13-17)10-15-5-4-6-18-16(15)21-3;2*3-2(4,5)1(6)7/h4-6,14H,7-13H2,1-3H3;2*(H,6,7)/t14-,17+;;/m1../s1 |
| InChIKey | XCSMJEXUEZYOCO-YSEASCLGSA-N |
| XLogP | 2.76 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |