C16H23F3N2O5S — CID 171694185
(3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 171694185) has the molecular formula C16H23F3N2O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694185 |
| Molecular Formula | C16H23F3N2O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (3R,3aR,6aS)-1-(2-methoxyethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1C[C@H](OCc2csc(C)n2)[C@H]2COC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N2O3S.C2HF3O2/c1-10-15-11(9-20-10)6-19-14-5-16(3-4-17-2)13-8-18-7-12(13)14;3-2(4,5)1(6)7/h9,12-14H,3-8H2,1-2H3;(H,6,7)/t12-,13+,14-;/m0./s1 |
| InChIKey | CSRAJQONNJZPHS-VDTKTRGNSA-N |
| XLogP | 1.95 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |