C23H29N3O4S — CID 17169595
N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-3-(2-methylpropoxy)benzamide (PubChem CID 17169595) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-3-(2-methylpropoxy)benzamide.
| Compound Name | N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17169595 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]-3-(2-methylpropoxy)benzamide |
| SMILES | Cc1ccc(OC(C)C(=O)NNC(=S)NC(=O)c2cccc(OCC(C)C)c2)cc1C |
| InChI | InChI=1S/C23H29N3O4S/c1-14(2)13-29-19-8-6-7-18(12-19)22(28)24-23(31)26-25-21(27)17(5)30-20-10-9-15(3)16(4)11-20/h6-12,14,17H,13H2,1-5H3,(H,25,27)(H2,24,26,28,31) |
| InChIKey | LSNBZCNJFWQIQY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|