C15H23F3N4O5S — CID 171696263
N-[(3S,3aR,7aS)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 171696263) has the molecular formula C15H23F3N4O5S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[(3S,3aR,7aS)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S,3aR,7aS)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171696263 |
| Molecular Formula | C15H23F3N4O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[(3S,3aR,7aS)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1ccnc1CN1C[C@H](NS(C)(=O)=O)[C@@H]2OCCC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H22N4O3S.C2HF3O2/c1-16-6-5-14-12(16)9-17-8-10(15-21(2,18)19)13-11(17)4-3-7-20-13;3-2(4,5)1(6)7/h5-6,10-11,13,15H,3-4,7-9H2,1-2H3;(H,6,7)/t10-,11-,13-;/m0./s1 |
| InChIKey | BAYOKROCKYRDBR-SQRKDXEHSA-N |
| XLogP | 0.33 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |