C19H29F3N4O5S — CID 171696309
(1S,5S,7R)-3-(3-methylbutyl)-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 171696309) has the molecular formula C19H29F3N4O5S and a molecular weight of 482.53 g/mol. Its IUPAC name is (1S,5S,7R)-3-(3-methylbutyl)-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,5S,7R)-3-(3-methylbutyl)-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171696309 |
| Molecular Formula | C19H29F3N4O5S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (1S,5S,7R)-3-(3-methylbutyl)-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CCN1C[C@@]23CN(Cc4cnn(C)c4)C[C@@H](C[C@@H]2S1(=O)=O)O3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N4O3S.C2HF3O2/c1-13(2)4-5-21-12-17-11-20(9-14-7-18-19(3)8-14)10-15(24-17)6-16(17)25(21,22)23;3-2(4,5)1(6)7/h7-8,13,15-16H,4-6,9-12H2,1-3H3;(H,6,7)/t15-,16+,17+;/m1./s1 |
| InChIKey | KKGULYROXDOGMP-LPZNKSAJSA-N |
| XLogP | 1.46 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |