C16H23F3N4O5S — CID 171697278
(1S,5S,7R)-3-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 171697278) has the molecular formula C16H23F3N4O5S and a molecular weight of 440.44 g/mol. Its IUPAC name is (1S,5S,7R)-3-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,5S,7R)-3-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171697278 |
| Molecular Formula | C16H23F3N4O5S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (1S,5S,7R)-3-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane 4,4-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C[C@@]23CN(Cc4cnn(C)c4)C[C@@H](C[C@@H]2S1(=O)=O)O3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O3S.C2HF3O2/c1-3-18-10-14-9-17(7-11-5-15-16(2)6-11)8-12(21-14)4-13(14)22(18,19)20;3-2(4,5)1(6)7/h5-6,12-13H,3-4,7-10H2,1-2H3;(H,6,7)/t12-,13+,14+;/m1./s1 |
| InChIKey | JLJNNMGNRMZBCO-UDYGKFQRSA-N |
| XLogP | 0.43 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |