C11H17NO — CID 17169740
2-(3,4-dimethylphenoxy)propan-1-amine (PubChem CID 17169740) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)propan-1-amine.
| Compound Name | 2-(3,4-dimethylphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 17169740 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)propan-1-amine |
| SMILES | Cc1ccc(OC(C)CN)cc1C |
| InChI | InChI=1S/C11H17NO/c1-8-4-5-11(6-9(8)2)13-10(3)7-12/h4-6,10H,7,12H2,1-3H3 |
| InChIKey | UHWNETBQPWKEAG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |