About 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine
5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine (PubChem CID 171698282) has the molecular formula C11H8ClN5
and a molecular weight of 245.67 g/mol. Its IUPAC name is 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine |
| PubChem CID | 171698282 |
| Molecular Formula | C11H8ClN5 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine |
| SMILES | Nc1cncc(-c2cnc3ccc(Cl)nn23)c1 |
| InChI | InChI=1S/C11H8ClN5/c12-10-1-2-11-15-6-9(17(11)16-10)7-3-8(13)5-14-4-7/h1-6H,13H2 |
| InChIKey | SDNPUAONJIGFAK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine?
The IUPAC name of 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine (CID 171698282) is 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine.
What is the SMILES notation for 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine?
The canonical SMILES for 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine is Nc1cncc(-c2cnc3ccc(Cl)nn23)c1.
What is the InChIKey of 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine?
The InChIKey is SDNPUAONJIGFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN5/c12-10-1-2-11-15-6-9(17(11)16-10)7-3-8(13)5-14-4-7/h1-6H,13H2.
What are the key properties of 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine?
5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine has a molecular weight of 245.67 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-chloroimidazo[1,2-b]pyridazin-3-yl)pyridin-3-amine is sourced from PubChem (CID 171698282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).