C21H26BrNO4 — CID 17169902
5-bromo-N-[3-(2-methoxyethoxy)phenyl]-2-(3-methylbutoxy)benzamide (PubChem CID 17169902) has the molecular formula C21H26BrNO4 and a molecular weight of 436.35 g/mol. Its IUPAC name is 5-bromo-N-[3-(2-methoxyethoxy)phenyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-[3-(2-methoxyethoxy)phenyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17169902 |
| Molecular Formula | C21H26BrNO4 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-bromo-N-[3-(2-methoxyethoxy)phenyl]-2-(3-methylbutoxy)benzamide |
| SMILES | COCCOc1cccc(NC(=O)c2cc(Br)ccc2OCCC(C)C)c1 |
| InChI | InChI=1S/C21H26BrNO4/c1-15(2)9-10-27-20-8-7-16(22)13-19(20)21(24)23-17-5-4-6-18(14-17)26-12-11-25-3/h4-8,13-15H,9-12H2,1-3H3,(H,23,24) |
| InChIKey | YLUQKKGLINJVQC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|