C29H39N5O7S — CID 171699581
(2R)-N-[(11S,14R)-4-benzyl-2,5,12-trioxo-14-propan-2-yl-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-11-yl]oxolane-2-carboxamide;formic acid (PubChem CID 171699581) has the molecular formula C29H39N5O7S and a molecular weight of 601.73 g/mol. Its IUPAC name is (2R)-N-[(11S,14R)-4-benzyl-2,5,12-trioxo-14-propan-2-yl-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-11-yl]oxolane-2-carboxamide;formic acid.
| Compound Name | (2R)-N-[(11S,14R)-4-benzyl-2,5,12-trioxo-14-propan-2-yl-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-11-yl]oxolane-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 171699581 |
| Molecular Formula | C29H39N5O7S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | (2R)-N-[(11S,14R)-4-benzyl-2,5,12-trioxo-14-propan-2-yl-16-thia-3,6,13,18-tetrazabicyclo[13.2.1]octadeca-1(17),15(18)-dien-11-yl]oxolane-2-carboxamide;formic acid |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H](NC(=O)[C@H]2CCCO2)CCCCNC(=O)C(Cc2ccccc2)NC(=O)c2csc1n2.O=CO |
| InChI | InChI=1S/C28H37N5O5S.CH2O2/c1-17(2)23-28-32-21(16-39-28)26(36)31-20(15-18-9-4-3-5-10-18)24(34)29-13-7-6-11-19(25(35)33-23)30-27(37)22-12-8-14-38-22;2-1-3/h3-5,9-10,16-17,19-20,22-23H,6-8,11-15H2,1-2H3,(H,29,34)(H,30,37)(H,31,36)(H,33,35);1H,(H,2,3)/t19-,20?,22+,23+;/m0./s1 |
| InChIKey | MRVFFKIKOWWELX-LZLSHSHXSA-N |
| XLogP | 1.96 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|