About 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one
3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one (PubChem CID 171699733) has the molecular formula C10H6BrF2NO2
and a molecular weight of 290.06 g/mol. Its IUPAC name is 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one |
| PubChem CID | 171699733 |
| Molecular Formula | C10H6BrF2NO2 |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one |
| SMILES | O=c1occn1Cc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H6BrF2NO2/c11-6-3-8(12)7(9(13)4-6)5-14-1-2-16-10(14)15/h1-4H,5H2 |
| InChIKey | VYFKEAQRBIYULX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one?
The IUPAC name of 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one (CID 171699733) is 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one.
What is the SMILES notation for 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one?
The canonical SMILES for 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one is O=c1occn1Cc1c(F)cc(Br)cc1F.
What is the InChIKey of 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one?
The InChIKey is VYFKEAQRBIYULX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF2NO2/c11-6-3-8(12)7(9(13)4-6)5-14-1-2-16-10(14)15/h1-4H,5H2.
What are the key properties of 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one?
3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one has a molecular weight of 290.06 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-2,6-difluorophenyl)methyl]-1,3-oxazol-2-one is sourced from PubChem (CID 171699733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).