About 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride
2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride (PubChem CID 171700204) has the molecular formula C17H25ClN2S
and a molecular weight of 324.92 g/mol. Its IUPAC name is 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride |
| PubChem CID | 171700204 |
| Molecular Formula | C17H25ClN2S |
| Molecular Weight | 324.92 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride |
| SMILES | CCN(CC)CCSc1nc2cc(C)ccc2cc1C.Cl |
| InChI | InChI=1S/C17H24N2S.ClH/c1-5-19(6-2)9-10-20-17-14(4)12-15-8-7-13(3)11-16(15)18-17;/h7-8,11-12H,5-6,9-10H2,1-4H3;1H |
| InChIKey | FJPQTCJOFHVOQE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride?
The IUPAC name of 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride (CID 171700204) is 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride.
What is the SMILES notation for 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride?
The canonical SMILES for 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride is CCN(CC)CCSc1nc2cc(C)ccc2cc1C.Cl.
What is the InChIKey of 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride?
The InChIKey is FJPQTCJOFHVOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2S.ClH/c1-5-19(6-2)9-10-20-17-14(4)12-15-8-7-13(3)11-16(15)18-17;/h7-8,11-12H,5-6,9-10H2,1-4H3;1H.
What are the key properties of 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride?
2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride has a molecular weight of 324.92 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethylquinolin-2-yl)sulfanyl-N,N-diethylethanamine;hydrochloride is sourced from PubChem (CID 171700204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).