C26H29FN2O8 — CID 171700270
(4E)-1-[2-(dimethylamino)ethyl]-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione;oxalic acid (PubChem CID 171700270) has the molecular formula C26H29FN2O8 and a molecular weight of 516.52 g/mol. Its IUPAC name is (4E)-1-[2-(dimethylamino)ethyl]-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione;oxalic acid.
| Compound Name | (4E)-1-[2-(dimethylamino)ethyl]-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione;oxalic acid |
|---|---|
| PubChem CID | 171700270 |
| Molecular Formula | C26H29FN2O8 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (4E)-1-[2-(dimethylamino)ethyl]-4-[(4-ethoxy-3-methylphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione;oxalic acid |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCN(C)C)C2c2ccc(F)cc2)cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H27FN2O4.C2H2O4/c1-5-31-19-11-8-17(14-15(19)2)22(28)20-21(16-6-9-18(25)10-7-16)27(13-12-26(3)4)24(30)23(20)29;3-1(4)2(5)6/h6-11,14,21,28H,5,12-13H2,1-4H3;(H,3,4)(H,5,6)/b22-20+; |
| InChIKey | YDFQYOXCTCMPQS-QPNALZDCSA-N |
| XLogP | 2.67 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|