About 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine
2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine (PubChem CID 171700819) has the molecular formula C13H18F3N3O
and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine.
Molecular Properties
| Compound Name | 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine |
| PubChem CID | 171700819 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine |
| SMILES | Cc1cncc(OC2CCN(CCC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C13H18F3N3O/c1-10-8-17-9-12(18-10)20-11-2-5-19(6-3-11)7-4-13(14,15)16/h8-9,11H,2-7H2,1H3 |
| InChIKey | GACDZOCLGTWOOR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine?
The IUPAC name of 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine (CID 171700819) is 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine.
What is the SMILES notation for 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine?
The canonical SMILES for 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine is Cc1cncc(OC2CCN(CCC(F)(F)F)CC2)n1.
What is the InChIKey of 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine?
The InChIKey is GACDZOCLGTWOOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3O/c1-10-8-17-9-12(18-10)20-11-2-5-19(6-3-11)7-4-13(14,15)16/h8-9,11H,2-7H2,1H3.
What are the key properties of 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine?
2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine has a molecular weight of 289.30 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]oxypyrazine is sourced from PubChem (CID 171700819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).