C18H19FN2O4 — CID 171701550
(3,4-dimethoxyphenyl)-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone (PubChem CID 171701550) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 171701550 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(Oc3cccc(F)n3)C2)cc1OC |
| InChI | InChI=1S/C18H19FN2O4/c1-23-14-7-6-12(10-15(14)24-2)18(22)21-9-8-13(11-21)25-17-5-3-4-16(19)20-17/h3-7,10,13H,8-9,11H2,1-2H3 |
| InChIKey | HXQRGSNLQDGGNL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|